C16H28N2O3 — CID 102893245
(3S)-3-[(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)methyl]-5-methylhexanoic acid (PubChem CID 102893245) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is (3S)-3-[(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)methyl]-5-methylhexanoic acid.
| Compound Name | (3S)-3-[(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)methyl]-5-methylhexanoic acid |
|---|---|
| PubChem CID | 102893245 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | (3S)-3-[(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrole-3-carbonylamino)methyl]-5-methylhexanoic acid |
| SMILES | CC(C)C[C@H](CNC(=O)C1NCC2CCCC21)CC(=O)O |
| InChI | InChI=1S/C16H28N2O3/c1-10(2)6-11(7-14(19)20)8-18-16(21)15-13-5-3-4-12(13)9-17-15/h10-13,15,17H,3-9H2,1-2H3,(H,18,21)(H,19,20)/t11-,12?,13?,15?/m0/s1 |
| InChIKey | VIHPIHQUWXUJSL-PXWWDBQQSA-N |
| XLogP | 1.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |