C14H28N2O2 — CID 102894343
N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2-methoxy-N-(2-methoxyethyl)ethanamine (PubChem CID 102894343) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2-methoxy-N-(2-methoxyethyl)ethanamine.
| Compound Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2-methoxy-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 102894343 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | N-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-ylmethyl)-2-methoxy-N-(2-methoxyethyl)ethanamine |
| SMILES | COCCN(CCOC)CC1NCC2CCCC21 |
| InChI | InChI=1S/C14H28N2O2/c1-17-8-6-16(7-9-18-2)11-14-13-5-3-4-12(13)10-15-14/h12-15H,3-11H2,1-2H3 |
| InChIKey | HKOLDRNVWHNFCW-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |