C17H21N3O — CID 102894580
5-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole (PubChem CID 102894580) has the molecular formula C17H21N3O and a molecular weight of 283.37 g/mol. Its IUPAC name is 5-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole.
| Compound Name | 5-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102894580 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 5-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-3-[(2-methylphenyl)methyl]-1,2,4-oxadiazole |
| SMILES | Cc1ccccc1Cc1noc(C2NCC3CCCC32)n1 |
| InChI | InChI=1S/C17H21N3O/c1-11-5-2-3-6-12(11)9-15-19-17(21-20-15)16-14-8-4-7-13(14)10-18-16/h2-3,5-6,13-14,16,18H,4,7-10H2,1H3 |
| InChIKey | BJTWOFVONHCJHV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |