C17H27N3O — CID 102894768
5-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-3-cyclooctyl-1,2,4-oxadiazole (PubChem CID 102894768) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 5-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-3-cyclooctyl-1,2,4-oxadiazole.
| Compound Name | 5-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-3-cyclooctyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 102894768 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 5-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-3-cyclooctyl-1,2,4-oxadiazole |
| SMILES | C1CCCC(c2noc(C3NCC4CCCC43)n2)CCC1 |
| InChI | InChI=1S/C17H27N3O/c1-2-4-7-12(8-5-3-1)16-19-17(21-20-16)15-14-10-6-9-13(14)11-18-15/h12-15,18H,1-11H2 |
| InChIKey | YCIKNJPVFFZDJY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |