C13H19BrN2S — CID 102894589
1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-N-[(5-bromothiophen-2-yl)methyl]methanamine (PubChem CID 102894589) has the molecular formula C13H19BrN2S and a molecular weight of 315.28 g/mol. Its IUPAC name is 1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-N-[(5-bromothiophen-2-yl)methyl]methanamine.
| Compound Name | 1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-N-[(5-bromothiophen-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 102894589 |
| Molecular Formula | C13H19BrN2S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 1-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)-N-[(5-bromothiophen-2-yl)methyl]methanamine |
| SMILES | Brc1ccc(CNCC2NCC3CCCC32)s1 |
| InChI | InChI=1S/C13H19BrN2S/c14-13-5-4-10(17-13)7-15-8-12-11-3-1-2-9(11)6-16-12/h4-5,9,11-12,15-16H,1-3,6-8H2 |
| InChIKey | LIHRKVHXCHKNPH-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |