C12H16BrNS — CID 60744369
N-[(5-bromothiophen-2-yl)methyl]-1-cyclohex-3-en-1-ylmethanamine (PubChem CID 60744369) has the molecular formula C12H16BrNS and a molecular weight of 286.24 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-1-cyclohex-3-en-1-ylmethanamine.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-1-cyclohex-3-en-1-ylmethanamine |
|---|---|
| PubChem CID | 60744369 |
| Molecular Formula | C12H16BrNS |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-1-cyclohex-3-en-1-ylmethanamine |
| SMILES | Brc1ccc(CNCC2CC=CCC2)s1 |
| InChI | InChI=1S/C12H16BrNS/c13-12-7-6-11(15-12)9-14-8-10-4-2-1-3-5-10/h1-2,6-7,10,14H,3-5,8-9H2 |
| InChIKey | DLCKERRWLLWFOZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|