C16H15N3O2 — CID 102894878
3-(3,5-dioxo-4,6-diazatricyclo[6.3.0.02,6]undecan-4-yl)benzonitrile (PubChem CID 102894878) has the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. Its IUPAC name is 3-(3,5-dioxo-4,6-diazatricyclo[6.3.0.02,6]undecan-4-yl)benzonitrile.
| Compound Name | 3-(3,5-dioxo-4,6-diazatricyclo[6.3.0.02,6]undecan-4-yl)benzonitrile |
|---|---|
| PubChem CID | 102894878 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 3-(3,5-dioxo-4,6-diazatricyclo[6.3.0.02,6]undecan-4-yl)benzonitrile |
| SMILES | N#Cc1cccc(N2C(=O)C3C4CCCC4CN3C2=O)c1 |
| InChI | InChI=1S/C16H15N3O2/c17-8-10-3-1-5-12(7-10)19-15(20)14-13-6-2-4-11(13)9-18(14)16(19)21/h1,3,5,7,11,13-14H,2,4,6,9H2 |
| InChIKey | FZQZCABTZZTYLX-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|