C16H18N2O3 — CID 102894880
4-(3-methoxyphenyl)-4,6-diazatricyclo[6.3.0.02,6]undecane-3,5-dione (PubChem CID 102894880) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-4,6-diazatricyclo[6.3.0.02,6]undecane-3,5-dione.
| Compound Name | 4-(3-methoxyphenyl)-4,6-diazatricyclo[6.3.0.02,6]undecane-3,5-dione |
|---|---|
| PubChem CID | 102894880 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-(3-methoxyphenyl)-4,6-diazatricyclo[6.3.0.02,6]undecane-3,5-dione |
| SMILES | COc1cccc(N2C(=O)C3C4CCCC4CN3C2=O)c1 |
| InChI | InChI=1S/C16H18N2O3/c1-21-12-6-3-5-11(8-12)18-15(19)14-13-7-2-4-10(13)9-17(14)16(18)20/h3,5-6,8,10,13-14H,2,4,7,9H2,1H3 |
| InChIKey | VWJMZPFYMGQPSX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|