C12H17F3N2O3 — CID 102895572
2-[2-(2,2,2-trifluoroethylamino)acetyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid (PubChem CID 102895572) has the molecular formula C12H17F3N2O3 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-[2-(2,2,2-trifluoroethylamino)acetyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid.
| Compound Name | 2-[2-(2,2,2-trifluoroethylamino)acetyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 102895572 |
| Molecular Formula | C12H17F3N2O3 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 2-[2-(2,2,2-trifluoroethylamino)acetyl]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-3-carboxylic acid |
| SMILES | O=C(O)C1C2CCCC2CN1C(=O)CNCC(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O3/c13-12(14,15)6-16-4-9(18)17-5-7-2-1-3-8(7)10(17)11(19)20/h7-8,10,16H,1-6H2,(H,19,20) |
| InChIKey | KYONRYQQDZBYOK-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |