C28H29FN8O3 — CID 10289614
7-[5-[[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]methyl]-3-pyridinyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine (PubChem CID 10289614) has the molecular formula C28H29FN8O3 and a molecular weight of 544.59 g/mol. Its IUPAC name is 7-[5-[[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]methyl]-3-pyridinyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine.
| Compound Name | 7-[5-[[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]methyl]-3-pyridinyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
|---|---|
| PubChem CID | 10289614 |
| Molecular Formula | C28H29FN8O3 |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 7-[5-[[4-[2-fluoro-4-(2-methoxyethoxy)phenyl]piperazin-1-yl]methyl]-3-pyridinyl]-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-5-amine |
| SMILES | COCCOc1ccc(N2CCN(Cc3cncc(-c4cc5nc(-c6ccco6)nn5c(N)n4)c3)CC2)c(F)c1 |
| InChI | InChI=1S/C28H29FN8O3/c1-38-11-12-39-21-4-5-24(22(29)14-21)36-8-6-35(7-9-36)18-19-13-20(17-31-16-19)23-15-26-33-27(25-3-2-10-40-25)34-37(26)28(30)32-23/h2-5,10,13-17H,6-9,11-12,18H2,1H3,(H2,30,32) |
| InChIKey | ZGLRIFWHYAGCNC-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|