C17H22O3S — CID 102896294
2-methyl-5-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)benzoic acid (PubChem CID 102896294) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-methyl-5-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)benzoic acid.
| Compound Name | 2-methyl-5-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 102896294 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-methyl-5-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)benzoic acid |
| SMILES | Cc1ccc(SCC2CCC3(CCCC3)O2)cc1C(=O)O |
| InChI | InChI=1S/C17H22O3S/c1-12-4-5-14(10-15(12)16(18)19)21-11-13-6-9-17(20-13)7-2-3-8-17/h4-5,10,13H,2-3,6-9,11H2,1H3,(H,18,19) |
| InChIKey | UEWLXCREFQKTAR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |