C17H25NOS — CID 102901176
N-methyl-1-[3-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)phenyl]methanamine (PubChem CID 102901176) has the molecular formula C17H25NOS and a molecular weight of 291.46 g/mol. Its IUPAC name is N-methyl-1-[3-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)phenyl]methanamine.
| Compound Name | N-methyl-1-[3-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)phenyl]methanamine |
|---|---|
| PubChem CID | 102901176 |
| Molecular Formula | C17H25NOS |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-methyl-1-[3-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)phenyl]methanamine |
| SMILES | CNCc1cccc(SCC2CCC3(CCCC3)O2)c1 |
| InChI | InChI=1S/C17H25NOS/c1-18-12-14-5-4-6-16(11-14)20-13-15-7-10-17(19-15)8-2-3-9-17/h4-6,11,15,18H,2-3,7-10,12-13H2,1H3 |
| InChIKey | XYAKVZXGXCJUJU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |