C16H21Cl2NO — CID 102896565
2,5-dichloro-N-(1-oxaspiro[4.5]decan-2-ylmethyl)aniline (PubChem CID 102896565) has the molecular formula C16H21Cl2NO and a molecular weight of 314.26 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-oxaspiro[4.5]decan-2-ylmethyl)aniline.
| Compound Name | 2,5-dichloro-N-(1-oxaspiro[4.5]decan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 102896565 |
| Molecular Formula | C16H21Cl2NO |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2,5-dichloro-N-(1-oxaspiro[4.5]decan-2-ylmethyl)aniline |
| SMILES | Clc1ccc(Cl)c(NCC2CCC3(CCCCC3)O2)c1 |
| InChI | InChI=1S/C16H21Cl2NO/c17-12-4-5-14(18)15(10-12)19-11-13-6-9-16(20-13)7-2-1-3-8-16/h4-5,10,13,19H,1-3,6-9,11H2 |
| InChIKey | ALSOQYDSAGEEDY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |