C15H19NO4 — CID 102898721
1-(1-oxaspiro[4.4]nonan-2-ylmethyl)-2-oxopyridine-4-carboxylic acid (PubChem CID 102898721) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 1-(1-oxaspiro[4.4]nonan-2-ylmethyl)-2-oxopyridine-4-carboxylic acid.
| Compound Name | 1-(1-oxaspiro[4.4]nonan-2-ylmethyl)-2-oxopyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 102898721 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-(1-oxaspiro[4.4]nonan-2-ylmethyl)-2-oxopyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccn(CC2CCC3(CCCC3)O2)c(=O)c1 |
| InChI | InChI=1S/C15H19NO4/c17-13-9-11(14(18)19)4-8-16(13)10-12-3-7-15(20-12)5-1-2-6-15/h4,8-9,12H,1-3,5-7,10H2,(H,18,19) |
| InChIKey | AXGXGFHYHXDKSF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |