C14H24O4S — CID 102899718
3-methyl-2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfinyl)butanoic acid (PubChem CID 102899718) has the molecular formula C14H24O4S and a molecular weight of 288.41 g/mol. Its IUPAC name is 3-methyl-2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfinyl)butanoic acid.
| Compound Name | 3-methyl-2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfinyl)butanoic acid |
|---|---|
| PubChem CID | 102899718 |
| Molecular Formula | C14H24O4S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-methyl-2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfinyl)butanoic acid |
| SMILES | CC(C)C(C(=O)O)S(=O)CC1CCC2(CCCC2)O1 |
| InChI | InChI=1S/C14H24O4S/c1-10(2)12(13(15)16)19(17)9-11-5-8-14(18-11)6-3-4-7-14/h10-12H,3-9H2,1-2H3,(H,15,16) |
| InChIKey | TWGGTOIRYAAKPU-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |