C13H22O3S — CID 102896297
2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)butanoic acid (PubChem CID 102896297) has the molecular formula C13H22O3S and a molecular weight of 258.38 g/mol. Its IUPAC name is 2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)butanoic acid.
| Compound Name | 2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 102896297 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 2-(1-oxaspiro[4.4]nonan-2-ylmethylsulfanyl)butanoic acid |
| SMILES | CCC(SCC1CCC2(CCCC2)O1)C(=O)O |
| InChI | InChI=1S/C13H22O3S/c1-2-11(12(14)15)17-9-10-5-8-13(16-10)6-3-4-7-13/h10-11H,2-9H2,1H3,(H,14,15) |
| InChIKey | IUHPLKOFSSFATM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |