About 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione
5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione (PubChem CID 102901058) has the molecular formula C16H24N2O3
and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione |
| PubChem CID | 102901058 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione |
| SMILES | CCc1cn(CC2CCC3(CCCCC3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H24N2O3/c1-2-12-10-18(15(20)17-14(12)19)11-13-6-9-16(21-13)7-4-3-5-8-16/h10,13H,2-9,11H2,1H3,(H,17,19,20) |
| InChIKey | ZBNGYVIEWKMNHD-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione?
The IUPAC name of 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione (CID 102901058) is 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione.
What is the SMILES notation for 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione?
The canonical SMILES for 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione is CCc1cn(CC2CCC3(CCCCC3)O2)c(=O)[nH]c1=O.
What is the InChIKey of 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione?
The InChIKey is ZBNGYVIEWKMNHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3/c1-2-12-10-18(15(20)17-14(12)19)11-13-6-9-16(21-13)7-4-3-5-8-16/h10,13H,2-9,11H2,1H3,(H,17,19,20).
What are the key properties of 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione?
5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione has a molecular weight of 292.38 g/mol, XLogP of 1.98, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrimidine-2,4-dione is sourced from PubChem (CID 102901058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).