C17H28N2O — CID 102901064
3,5-diethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrazole (PubChem CID 102901064) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 3,5-diethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrazole.
| Compound Name | 3,5-diethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrazole |
|---|---|
| PubChem CID | 102901064 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 3,5-diethyl-1-(1-oxaspiro[4.5]decan-2-ylmethyl)pyrazole |
| SMILES | CCc1cc(CC)n(CC2CCC3(CCCCC3)O2)n1 |
| InChI | InChI=1S/C17H28N2O/c1-3-14-12-15(4-2)19(18-14)13-16-8-11-17(20-16)9-6-5-7-10-17/h12,16H,3-11,13H2,1-2H3 |
| InChIKey | BOAZTSGPYOVFJH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |