C12H21N3 — CID 102819892
3,5-diethyl-1-[[(2R)-pyrrolidin-2-yl]methyl]pyrazole (PubChem CID 102819892) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 3,5-diethyl-1-[[(2R)-pyrrolidin-2-yl]methyl]pyrazole.
| Compound Name | 3,5-diethyl-1-[[(2R)-pyrrolidin-2-yl]methyl]pyrazole |
|---|---|
| PubChem CID | 102819892 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3,5-diethyl-1-[[(2R)-pyrrolidin-2-yl]methyl]pyrazole |
| SMILES | CCc1cc(CC)n(C[C@H]2CCCN2)n1 |
| InChI | InChI=1S/C12H21N3/c1-3-10-8-12(4-2)15(14-10)9-11-6-5-7-13-11/h8,11,13H,3-7,9H2,1-2H3/t11-/m1/s1 |
| InChIKey | WRNRCFOZOTUMKQ-LLVKDONJSA-N |
| XLogP | 1.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |