C13H20F3N3 — CID 106779970
2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-3-(trifluoromethyl)piperidine (PubChem CID 106779970) has the molecular formula C13H20F3N3 and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-3-(trifluoromethyl)piperidine.
| Compound Name | 2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-3-(trifluoromethyl)piperidine |
|---|---|
| PubChem CID | 106779970 |
| Molecular Formula | C13H20F3N3 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 2-[(3-ethyl-1-methylpyrazol-5-yl)methyl]-3-(trifluoromethyl)piperidine |
| SMILES | CCc1cc(CC2NCCCC2C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C13H20F3N3/c1-3-9-7-10(19(2)18-9)8-12-11(13(14,15)16)5-4-6-17-12/h7,11-12,17H,3-6,8H2,1-2H3 |
| InChIKey | NZCWWFXENZHGHP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |