C14H18BrN3O — CID 102902429
2-[2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methoxy]ethyl]aniline (PubChem CID 102902429) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is 2-[2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methoxy]ethyl]aniline.
| Compound Name | 2-[2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methoxy]ethyl]aniline |
|---|---|
| PubChem CID | 102902429 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2-[2-[(4-bromo-1,3-dimethylpyrazol-5-yl)methoxy]ethyl]aniline |
| SMILES | Cc1nn(C)c(COCCc2ccccc2N)c1Br |
| InChI | InChI=1S/C14H18BrN3O/c1-10-14(15)13(18(2)17-10)9-19-8-7-11-5-3-4-6-12(11)16/h3-6H,7-9,16H2,1-2H3 |
| InChIKey | NKWXSAGZQBXNFE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|