C12H21BrN2O — CID 66225828
4-bromo-5-(3,3-dimethylbutoxymethyl)-1,3-dimethylpyrazole (PubChem CID 66225828) has the molecular formula C12H21BrN2O and a molecular weight of 289.22 g/mol. Its IUPAC name is 4-bromo-5-(3,3-dimethylbutoxymethyl)-1,3-dimethylpyrazole.
| Compound Name | 4-bromo-5-(3,3-dimethylbutoxymethyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 66225828 |
| Molecular Formula | C12H21BrN2O |
| Molecular Weight | 289.22 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4-bromo-5-(3,3-dimethylbutoxymethyl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)c(COCCC(C)(C)C)c1Br |
| InChI | InChI=1S/C12H21BrN2O/c1-9-11(13)10(15(5)14-9)8-16-7-6-12(2,3)4/h6-8H2,1-5H3 |
| InChIKey | PYOKMBDYLXCILQ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|