C8H11BrF3N3O — CID 82722264
1-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine (PubChem CID 82722264) has the molecular formula C8H11BrF3N3O and a molecular weight of 302.09 g/mol. Its IUPAC name is 1-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine.
| Compound Name | 1-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
|---|---|
| PubChem CID | 82722264 |
| Molecular Formula | C8H11BrF3N3O |
| Molecular Weight | 302.09 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 1-(4-bromo-1,3-dimethylpyrazol-5-yl)-N-(2,2,2-trifluoroethoxy)methanamine |
| SMILES | Cc1nn(C)c(CNOCC(F)(F)F)c1Br |
| InChI | InChI=1S/C8H11BrF3N3O/c1-5-7(9)6(15(2)14-5)3-13-16-4-8(10,11)12/h13H,3-4H2,1-2H3 |
| InChIKey | IPPVQHQUSICRIY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.09 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|