C15H16N4O — CID 102906780
3-[2-(2-methoxyethyl)phenyl]imidazo[4,5-b]pyridin-2-amine (PubChem CID 102906780) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 3-[2-(2-methoxyethyl)phenyl]imidazo[4,5-b]pyridin-2-amine.
| Compound Name | 3-[2-(2-methoxyethyl)phenyl]imidazo[4,5-b]pyridin-2-amine |
|---|---|
| PubChem CID | 102906780 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-[2-(2-methoxyethyl)phenyl]imidazo[4,5-b]pyridin-2-amine |
| SMILES | COCCc1ccccc1-n1c(N)nc2cccnc21 |
| InChI | InChI=1S/C15H16N4O/c1-20-10-8-11-5-2-3-7-13(11)19-14-12(18-15(19)16)6-4-9-17-14/h2-7,9H,8,10H2,1H3,(H2,16,18) |
| InChIKey | LWMVUJIRVKCIAW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |