About 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol
2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol (PubChem CID 10290771) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol |
| PubChem CID | 10290771 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol |
| SMILES | CC[C@H]1O[C@H]1CCO |
| InChI | InChI=1S/C6H12O2/c1-2-5-6(8-5)3-4-7/h5-7H,2-4H2,1H3/t5-,6+/m1/s1 |
| InChIKey | STHLKDCSDYFCCW-RITPCOANSA-N |
| XLogP | 0.55 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol?
The IUPAC name of 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol (CID 10290771) is 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol.
What is the SMILES notation for 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol?
The canonical SMILES for 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol is CC[C@H]1O[C@H]1CCO.
What is the InChIKey of 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol?
The InChIKey is STHLKDCSDYFCCW-RITPCOANSA-N. The full InChI is InChI=1S/C6H12O2/c1-2-5-6(8-5)3-4-7/h5-7H,2-4H2,1H3/t5-,6+/m1/s1.
What are the key properties of 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol?
2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol has a molecular weight of 116.16 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,3R)-3-ethyloxiran-2-yl]ethanol is sourced from PubChem (CID 10290771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).