C12H14N2O — CID 102908049
8-(2-methoxyethyl)quinolin-4-amine (PubChem CID 102908049) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is 8-(2-methoxyethyl)quinolin-4-amine.
| Compound Name | 8-(2-methoxyethyl)quinolin-4-amine |
|---|---|
| PubChem CID | 102908049 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 8-(2-methoxyethyl)quinolin-4-amine |
| SMILES | COCCc1cccc2c(N)ccnc12 |
| InChI | InChI=1S/C12H14N2O/c1-15-8-6-9-3-2-4-10-11(13)5-7-14-12(9)10/h2-5,7H,6,8H2,1H3,(H2,13,14) |
| InChIKey | XOKLWOQEDLQQGZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |