C15H11F3N2 — CID 102909199
2,3,4-trifluoro-N-(1H-indol-5-ylmethyl)aniline (PubChem CID 102909199) has the molecular formula C15H11F3N2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(1H-indol-5-ylmethyl)aniline.
| Compound Name | 2,3,4-trifluoro-N-(1H-indol-5-ylmethyl)aniline |
|---|---|
| PubChem CID | 102909199 |
| Molecular Formula | C15H11F3N2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2,3,4-trifluoro-N-(1H-indol-5-ylmethyl)aniline |
| SMILES | Fc1ccc(NCc2ccc3[nH]ccc3c2)c(F)c1F |
| InChI | InChI=1S/C15H11F3N2/c16-11-2-4-13(15(18)14(11)17)20-8-9-1-3-12-10(7-9)5-6-19-12/h1-7,19-20H,8H2 |
| InChIKey | WZTKSUKJFYGFSK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|