C16H14N4 — CID 102910187
N-(1H-indol-5-ylmethyl)-1H-indazol-4-amine (PubChem CID 102910187) has the molecular formula C16H14N4 and a molecular weight of 262.32 g/mol. Its IUPAC name is N-(1H-indol-5-ylmethyl)-1H-indazol-4-amine.
| Compound Name | N-(1H-indol-5-ylmethyl)-1H-indazol-4-amine |
|---|---|
| PubChem CID | 102910187 |
| Molecular Formula | C16H14N4 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | N-(1H-indol-5-ylmethyl)-1H-indazol-4-amine |
| SMILES | c1cc(NCc2ccc3[nH]ccc3c2)c2cn[nH]c2c1 |
| InChI | InChI=1S/C16H14N4/c1-2-15(13-10-19-20-16(13)3-1)18-9-11-4-5-14-12(8-11)6-7-17-14/h1-8,10,17-18H,9H2,(H,19,20) |
| InChIKey | GFGFJEWTEMJEGL-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |