C14H16N4 — CID 102909486
N-(1H-indol-5-ylmethyl)-3,5-dimethyl-1H-pyrazol-4-amine (PubChem CID 102909486) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is N-(1H-indol-5-ylmethyl)-3,5-dimethyl-1H-pyrazol-4-amine.
| Compound Name | N-(1H-indol-5-ylmethyl)-3,5-dimethyl-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 102909486 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | N-(1H-indol-5-ylmethyl)-3,5-dimethyl-1H-pyrazol-4-amine |
| SMILES | Cc1n[nH]c(C)c1NCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C14H16N4/c1-9-14(10(2)18-17-9)16-8-11-3-4-13-12(7-11)5-6-15-13/h3-7,15-16H,8H2,1-2H3,(H,17,18) |
| InChIKey | PEYIIPHTUQSLHL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 56.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |