C19H19NO — CID 102909906
1-[(2,4,6-trimethylphenyl)methyl]indole-7-carbaldehyde (PubChem CID 102909906) has the molecular formula C19H19NO and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-[(2,4,6-trimethylphenyl)methyl]indole-7-carbaldehyde.
| Compound Name | 1-[(2,4,6-trimethylphenyl)methyl]indole-7-carbaldehyde |
|---|---|
| PubChem CID | 102909906 |
| Molecular Formula | C19H19NO |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 1-[(2,4,6-trimethylphenyl)methyl]indole-7-carbaldehyde |
| SMILES | Cc1cc(C)c(Cn2ccc3cccc(C=O)c32)c(C)c1 |
| InChI | InChI=1S/C19H19NO/c1-13-9-14(2)18(15(3)10-13)11-20-8-7-16-5-4-6-17(12-21)19(16)20/h4-10,12H,11H2,1-3H3 |
| InChIKey | CUROWTLPWIFQIK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|