C18H18ClN — CID 103475068
7-chloro-1-[(2,4,6-trimethylphenyl)methyl]indole (PubChem CID 103475068) has the molecular formula C18H18ClN and a molecular weight of 283.80 g/mol. Its IUPAC name is 7-chloro-1-[(2,4,6-trimethylphenyl)methyl]indole.
| Compound Name | 7-chloro-1-[(2,4,6-trimethylphenyl)methyl]indole |
|---|---|
| PubChem CID | 103475068 |
| Molecular Formula | C18H18ClN |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 7-chloro-1-[(2,4,6-trimethylphenyl)methyl]indole |
| SMILES | Cc1cc(C)c(Cn2ccc3cccc(Cl)c32)c(C)c1 |
| InChI | InChI=1S/C18H18ClN/c1-12-9-13(2)16(14(3)10-12)11-20-8-7-15-5-4-6-17(19)18(15)20/h4-10H,11H2,1-3H3 |
| InChIKey | QXNLSCUKKPBAND-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |