C15H10ClF2N — CID 103475121
7-chloro-1-[(2,6-difluorophenyl)methyl]indole (PubChem CID 103475121) has the molecular formula C15H10ClF2N and a molecular weight of 277.70 g/mol. Its IUPAC name is 7-chloro-1-[(2,6-difluorophenyl)methyl]indole.
| Compound Name | 7-chloro-1-[(2,6-difluorophenyl)methyl]indole |
|---|---|
| PubChem CID | 103475121 |
| Molecular Formula | C15H10ClF2N |
| Molecular Weight | 277.70 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 7-chloro-1-[(2,6-difluorophenyl)methyl]indole |
| SMILES | Fc1cccc(F)c1Cn1ccc2cccc(Cl)c21 |
| InChI | InChI=1S/C15H10ClF2N/c16-12-4-1-3-10-7-8-19(15(10)12)9-11-13(17)5-2-6-14(11)18/h1-8H,9H2 |
| InChIKey | GZPKOCCIHMZZMP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |