C12H9ClN2S — CID 103475549
5-[(7-chloroindol-1-yl)methyl]-1,3-thiazole (PubChem CID 103475549) has the molecular formula C12H9ClN2S and a molecular weight of 248.74 g/mol. Its IUPAC name is 5-[(7-chloroindol-1-yl)methyl]-1,3-thiazole.
| Compound Name | 5-[(7-chloroindol-1-yl)methyl]-1,3-thiazole |
|---|---|
| PubChem CID | 103475549 |
| Molecular Formula | C12H9ClN2S |
| Molecular Weight | 248.74 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 5-[(7-chloroindol-1-yl)methyl]-1,3-thiazole |
| SMILES | Clc1cccc2ccn(Cc3cncs3)c12 |
| InChI | InChI=1S/C12H9ClN2S/c13-11-3-1-2-9-4-5-15(12(9)11)7-10-6-14-8-16-10/h1-6,8H,7H2 |
| InChIKey | WHJLETFEQLVWFG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.74 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |