C14H14ClN3O — CID 103475272
5-[(7-chloroindol-1-yl)methyl]-3-propan-2-yl-1,2,4-oxadiazole (PubChem CID 103475272) has the molecular formula C14H14ClN3O and a molecular weight of 275.74 g/mol. Its IUPAC name is 5-[(7-chloroindol-1-yl)methyl]-3-propan-2-yl-1,2,4-oxadiazole.
| Compound Name | 5-[(7-chloroindol-1-yl)methyl]-3-propan-2-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103475272 |
| Molecular Formula | C14H14ClN3O |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 5-[(7-chloroindol-1-yl)methyl]-3-propan-2-yl-1,2,4-oxadiazole |
| SMILES | CC(C)c1noc(Cn2ccc3cccc(Cl)c32)n1 |
| InChI | InChI=1S/C14H14ClN3O/c1-9(2)14-16-12(19-17-14)8-18-7-6-10-4-3-5-11(15)13(10)18/h3-7,9H,8H2,1-2H3 |
| InChIKey | ZCAMECMWORYDRA-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |