C13H9N3S — CID 107920256
1-(1,3-thiazol-5-ylmethyl)indole-5-carbonitrile (PubChem CID 107920256) has the molecular formula C13H9N3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 1-(1,3-thiazol-5-ylmethyl)indole-5-carbonitrile.
| Compound Name | 1-(1,3-thiazol-5-ylmethyl)indole-5-carbonitrile |
|---|---|
| PubChem CID | 107920256 |
| Molecular Formula | C13H9N3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 1-(1,3-thiazol-5-ylmethyl)indole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(ccn2Cc2cncs2)c1 |
| InChI | InChI=1S/C13H9N3S/c14-6-10-1-2-13-11(5-10)3-4-16(13)8-12-7-15-9-17-12/h1-5,7,9H,8H2 |
| InChIKey | XJZADMYZHOHUAK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |