C19H24N4O2 — CID 10291025
8-cyclohexyl-3-ethyl-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one (PubChem CID 10291025) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 8-cyclohexyl-3-ethyl-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one.
| Compound Name | 8-cyclohexyl-3-ethyl-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
|---|---|
| PubChem CID | 10291025 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 8-cyclohexyl-3-ethyl-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one |
| SMILES | CCc1nc(C)c2c(=O)n(C3CCCCC3)c3ccc(OC)nc3n12 |
| InChI | InChI=1S/C19H24N4O2/c1-4-15-20-12(2)17-19(24)22(13-8-6-5-7-9-13)14-10-11-16(25-3)21-18(14)23(15)17/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | MHJFPDFZBMUALY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |