C29H38IN5O2 — CID 110173364
8-[3-(4-benzyl-1-methylpiperidin-1-ium-1-yl)propyl]-3-ethyl-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one iodide (PubChem CID 110173364) has the molecular formula C29H38IN5O2 and a molecular weight of 615.56 g/mol. Its IUPAC name is 8-[3-(4-benzyl-1-methylpiperidin-1-ium-1-yl)propyl]-3-ethyl-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one iodide.
| Compound Name | 8-[3-(4-benzyl-1-methylpiperidin-1-ium-1-yl)propyl]-3-ethyl-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one iodide |
|---|---|
| PubChem CID | 110173364 |
| Molecular Formula | C29H38IN5O2 |
| Molecular Weight | 615.56 g/mol |
| Exact Mass | 615.21 |
| IUPAC Name | 8-[3-(4-benzyl-1-methylpiperidin-1-ium-1-yl)propyl]-3-ethyl-12-methoxy-5-methyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,10,12-pentaen-7-one iodide |
| SMILES | CCc1nc(C)c2c(=O)n(CCC[N+]3(C)CCC(Cc4ccccc4)CC3)c3ccc(OC)nc3n12.[I-] |
| InChI | InChI=1S/C29H38N5O2.HI/c1-5-25-30-21(2)27-29(35)32(24-12-13-26(36-4)31-28(24)33(25)27)16-9-17-34(3)18-14-23(15-19-34)20-22-10-7-6-8-11-22;/h6-8,10-13,23H,5,9,14-20H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | NGXBPGJFVBPHRX-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.56 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|