C17H24N2 — CID 102911435
N-(1H-indol-5-ylmethyl)-2,2-dimethylcyclohexan-1-amine (PubChem CID 102911435) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-(1H-indol-5-ylmethyl)-2,2-dimethylcyclohexan-1-amine.
| Compound Name | N-(1H-indol-5-ylmethyl)-2,2-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 102911435 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | N-(1H-indol-5-ylmethyl)-2,2-dimethylcyclohexan-1-amine |
| SMILES | CC1(C)CCCCC1NCc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C17H24N2/c1-17(2)9-4-3-5-16(17)19-12-13-6-7-15-14(11-13)8-10-18-15/h6-8,10-11,16,18-19H,3-5,9,12H2,1-2H3 |
| InChIKey | ZCHUNFCFENSPLK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |