C13H22N2 — CID 79861656
2,2-dimethyl-N-(1H-pyrrol-2-ylmethyl)cyclohexan-1-amine (PubChem CID 79861656) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,2-dimethyl-N-(1H-pyrrol-2-ylmethyl)cyclohexan-1-amine.
| Compound Name | 2,2-dimethyl-N-(1H-pyrrol-2-ylmethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 79861656 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2,2-dimethyl-N-(1H-pyrrol-2-ylmethyl)cyclohexan-1-amine |
| SMILES | CC1(C)CCCCC1NCc1ccc[nH]1 |
| InChI | InChI=1S/C13H22N2/c1-13(2)8-4-3-7-12(13)15-10-11-6-5-9-14-11/h5-6,9,12,14-15H,3-4,7-8,10H2,1-2H3 |
| InChIKey | BRPVSSZFOCZGQR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |