C19H14N4OS — CID 10291291
N-(3-phenoxyphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine (PubChem CID 10291291) has the molecular formula C19H14N4OS and a molecular weight of 346.42 g/mol. Its IUPAC name is N-(3-phenoxyphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine.
| Compound Name | N-(3-phenoxyphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 10291291 |
| Molecular Formula | C19H14N4OS |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-(3-phenoxyphenyl)-4-(1,3-thiazol-2-yl)pyrimidin-2-amine |
| SMILES | c1ccc(Oc2cccc(Nc3nccc(-c4nccs4)n3)c2)cc1 |
| InChI | InChI=1S/C19H14N4OS/c1-2-6-15(7-3-1)24-16-8-4-5-14(13-16)22-19-21-10-9-17(23-19)18-20-11-12-25-18/h1-13H,(H,21,22,23) |
| InChIKey | JDMSPHKFVGVCKN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |