C15H19F3N2O — CID 102914619
N-[[1-[2-(trifluoromethoxy)ethyl]indol-7-yl]methyl]propan-2-amine (PubChem CID 102914619) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is N-[[1-[2-(trifluoromethoxy)ethyl]indol-7-yl]methyl]propan-2-amine.
| Compound Name | N-[[1-[2-(trifluoromethoxy)ethyl]indol-7-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 102914619 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-[[1-[2-(trifluoromethoxy)ethyl]indol-7-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1cccc2ccn(CCOC(F)(F)F)c12 |
| InChI | InChI=1S/C15H19F3N2O/c1-11(2)19-10-13-5-3-4-12-6-7-20(14(12)13)8-9-21-15(16,17)18/h3-7,11,19H,8-10H2,1-2H3 |
| InChIKey | ARKMOLKOJFBGMU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |