C15H19F3N2O — CID 102914312
N-[[1-[2-(trifluoromethoxy)ethyl]indol-7-yl]methyl]propan-1-amine (PubChem CID 102914312) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is N-[[1-[2-(trifluoromethoxy)ethyl]indol-7-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[2-(trifluoromethoxy)ethyl]indol-7-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102914312 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | N-[[1-[2-(trifluoromethoxy)ethyl]indol-7-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc2ccn(CCOC(F)(F)F)c12 |
| InChI | InChI=1S/C15H19F3N2O/c1-2-7-19-11-13-5-3-4-12-6-8-20(14(12)13)9-10-21-15(16,17)18/h3-6,8,19H,2,7,9-11H2,1H3 |
| InChIKey | MHFZIEWGUUBLGH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|