C15H22N2O — CID 102914380
N-[[1-(ethoxymethyl)indol-7-yl]methyl]propan-1-amine (PubChem CID 102914380) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is N-[[1-(ethoxymethyl)indol-7-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-(ethoxymethyl)indol-7-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 102914380 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | N-[[1-(ethoxymethyl)indol-7-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccc2ccn(COCC)c12 |
| InChI | InChI=1S/C15H22N2O/c1-3-9-16-11-14-7-5-6-13-8-10-17(15(13)14)12-18-4-2/h5-8,10,16H,3-4,9,11-12H2,1-2H3 |
| InChIKey | OTDLWLFLDGBEBX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|