C14H17N3 — CID 102914342
2-[7-(propylaminomethyl)indol-1-yl]acetonitrile (PubChem CID 102914342) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-[7-(propylaminomethyl)indol-1-yl]acetonitrile.
| Compound Name | 2-[7-(propylaminomethyl)indol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 102914342 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-[7-(propylaminomethyl)indol-1-yl]acetonitrile |
| SMILES | CCCNCc1cccc2ccn(CC#N)c12 |
| InChI | InChI=1S/C14H17N3/c1-2-8-16-11-13-5-3-4-12-6-9-17(10-7-15)14(12)13/h3-6,9,16H,2,8,10-11H2,1H3 |
| InChIKey | CNONGKRVEWVXAW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|