C18H31N3 — CID 102915282
5-[(cyclopropylamino)methyl]-6-methyl-N-(3-methyl-2-propan-2-ylbutyl)pyridin-2-amine (PubChem CID 102915282) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is 5-[(cyclopropylamino)methyl]-6-methyl-N-(3-methyl-2-propan-2-ylbutyl)pyridin-2-amine.
| Compound Name | 5-[(cyclopropylamino)methyl]-6-methyl-N-(3-methyl-2-propan-2-ylbutyl)pyridin-2-amine |
|---|---|
| PubChem CID | 102915282 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | 5-[(cyclopropylamino)methyl]-6-methyl-N-(3-methyl-2-propan-2-ylbutyl)pyridin-2-amine |
| SMILES | Cc1nc(NCC(C(C)C)C(C)C)ccc1CNC1CC1 |
| InChI | InChI=1S/C18H31N3/c1-12(2)17(13(3)4)11-20-18-9-6-15(14(5)21-18)10-19-16-7-8-16/h6,9,12-13,16-17,19H,7-8,10-11H2,1-5H3,(H,20,21) |
| InChIKey | FYXQOSGKCYVPPF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |