C16H23N3O2 — CID 102916591
N-(1-methoxypropan-2-yl)-2-[6-(methylaminomethyl)indol-1-yl]acetamide (PubChem CID 102916591) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(1-methoxypropan-2-yl)-2-[6-(methylaminomethyl)indol-1-yl]acetamide.
| Compound Name | N-(1-methoxypropan-2-yl)-2-[6-(methylaminomethyl)indol-1-yl]acetamide |
|---|---|
| PubChem CID | 102916591 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | N-(1-methoxypropan-2-yl)-2-[6-(methylaminomethyl)indol-1-yl]acetamide |
| SMILES | CNCc1ccc2ccn(CC(=O)NC(C)COC)c2c1 |
| InChI | InChI=1S/C16H23N3O2/c1-12(11-21-3)18-16(20)10-19-7-6-14-5-4-13(9-17-2)8-15(14)19/h4-8,12,17H,9-11H2,1-3H3,(H,18,20) |
| InChIKey | YPXJCKVMAHUUPL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |