C22H28O4 — CID 10291798
[(1R,2S,8R,10S,11S,12S,15S,16S,18R)-2,15,16-trimethyl-5-oxo-19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadec-6-en-15-yl] formate (PubChem CID 10291798) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is [(1R,2S,8R,10S,11S,12S,15S,16S,18R)-2,15,16-trimethyl-5-oxo-19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadec-6-en-15-yl] formate.
| Compound Name | [(1R,2S,8R,10S,11S,12S,15S,16S,18R)-2,15,16-trimethyl-5-oxo-19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadec-6-en-15-yl] formate |
|---|---|
| PubChem CID | 10291798 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(1R,2S,8R,10S,11S,12S,15S,16S,18R)-2,15,16-trimethyl-5-oxo-19-oxahexacyclo[9.8.0.01,18.02,7.08,10.012,16]nonadec-6-en-15-yl] formate |
| SMILES | C[C@]12CCC(=O)C=C1[C@@H]1C[C@@H]1[C@H]1[C@@H]3CC[C@](C)(OC=O)[C@@]3(C)C[C@H]3O[C@@]132 |
| InChI | InChI=1S/C22H28O4/c1-19-6-4-12(24)8-16(19)13-9-14(13)18-15-5-7-21(3,25-11-23)20(15,2)10-17-22(18,19)26-17/h8,11,13-15,17-18H,4-7,9-10H2,1-3H3/t13-,14+,15+,17-,18+,19+,20+,21+,22-/m1/s1 |
| InChIKey | JKZQTXJZAUQLHB-LPRCFZGHSA-N |
| XLogP | 3.44 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|