C25H32O6 — CID 89374453
methyl 2-[(1R,9S,14R)-2,15-dimethyl-5,5'-dioxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,2'-oxolane]-9-yl]acetate (PubChem CID 89374453) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is methyl 2-[(1R,9S,14R)-2,15-dimethyl-5,5'-dioxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,2'-oxolane]-9-yl]acetate.
| Compound Name | methyl 2-[(1R,9S,14R)-2,15-dimethyl-5,5'-dioxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,2'-oxolane]-9-yl]acetate |
|---|---|
| PubChem CID | 89374453 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | methyl 2-[(1R,9S,14R)-2,15-dimethyl-5,5'-dioxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,2'-oxolane]-9-yl]acetate |
| SMILES | COC(=O)CC1CC2=CC(=O)CCC2(C)[C@@]23OC2CC2(C)C(CC[C@@]24CCC(=O)O4)C13 |
| InChI | InChI=1S/C25H32O6/c1-22-7-4-16(26)12-15(22)10-14(11-20(28)29-3)21-17-5-8-24(9-6-19(27)31-24)23(17,2)13-18-25(21,22)30-18/h12,14,17-18,21H,4-11,13H2,1-3H3/t14?,17?,18?,21?,22?,23?,24-,25-/m1/s1 |
| InChIKey | KCEZUUBWVBDXLV-FBORHHISSA-N |
| XLogP | 3.51 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|