C27H36O6 — CID 89301497
methyl 2-[(1R,2S,9R,14R,15S,17R)-5-(2-hydroxyethyl)-2,15-dimethyl-5'-oxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-5,7-diene-14,2'-oxolane]-9-yl]acetate (PubChem CID 89301497) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is methyl 2-[(1R,2S,9R,14R,15S,17R)-5-(2-hydroxyethyl)-2,15-dimethyl-5'-oxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-5,7-diene-14,2'-oxolane]-9-yl]acetate.
| Compound Name | methyl 2-[(1R,2S,9R,14R,15S,17R)-5-(2-hydroxyethyl)-2,15-dimethyl-5'-oxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-5,7-diene-14,2'-oxolane]-9-yl]acetate |
|---|---|
| PubChem CID | 89301497 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | methyl 2-[(1R,2S,9R,14R,15S,17R)-5-(2-hydroxyethyl)-2,15-dimethyl-5'-oxospiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-5,7-diene-14,2'-oxolane]-9-yl]acetate |
| SMILES | COC(=O)CC1C=C2C=C(CCO)CC[C@]2(C)[C@@]23O[C@@H]2C[C@@]2(C)C(CC[C@@]24CCC(=O)O4)C13 |
| InChI | InChI=1S/C27H36O6/c1-24-8-4-16(7-11-28)12-18(24)13-17(14-22(30)31-3)23-19-5-9-26(10-6-21(29)33-26)25(19,2)15-20-27(23,24)32-20/h12-13,17,19-20,23,28H,4-11,14-15H2,1-3H3/t17?,19?,20-,23?,24+,25+,26-,27-/m1/s1 |
| InChIKey | PXCQFPLVJWSUDD-JSTWAQEASA-N |
| XLogP | 3.86 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|