C24H27O6Rb — CID 59769803
(1R,2S,9R,10R,11S,14R,15S,17R)-2,15-dimethyl-9-(2-oxoacetyl)spiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,5'-oxolane]-2',5-dione;rubidium(1+) (PubChem CID 59769803) has the molecular formula C24H27O6Rb and a molecular weight of 496.94 g/mol. Its IUPAC name is (1R,2S,9R,10R,11S,14R,15S,17R)-2,15-dimethyl-9-(2-oxoacetyl)spiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,5'-oxolane]-2',5-dione;rubidium(1+).
| Compound Name | (1R,2S,9R,10R,11S,14R,15S,17R)-2,15-dimethyl-9-(2-oxoacetyl)spiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,5'-oxolane]-2',5-dione;rubidium(1+) |
|---|---|
| PubChem CID | 59769803 |
| Molecular Formula | C24H27O6Rb |
| Molecular Weight | 496.94 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | (1R,2S,9R,10R,11S,14R,15S,17R)-2,15-dimethyl-9-(2-oxoacetyl)spiro[18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadec-6-ene-14,5'-oxolane]-2',5-dione;rubidium(1+) |
| SMILES | C[C@]12CCC(=O)C=C1C[C@@H](C(=O)[C-]=O)[C@H]1[C@@H]3CC[C@@]4(CCC(=O)O4)[C@@]3(C)C[C@H]3O[C@@]132.[Rb+] |
| InChI | InChI=1S/C24H27O6.Rb/c1-21-6-3-14(26)9-13(21)10-15(17(27)12-25)20-16-4-7-23(8-5-19(28)30-23)22(16,2)11-18-24(20,21)29-18;/h9,15-16,18,20H,3-8,10-11H2,1-2H3;/q-1;+1/t15-,16-,18+,20-,21-,22-,23+,24+;/m0./s1 |
| InChIKey | WPXXQFFAZLMINO-DVGYPLQCSA-N |
| XLogP | -0.37 |
| TPSA | 90.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.94 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|